C27H43ClN4O3 — CID 68714483
3-[5-amino-1-(3-chlorophenyl)-1-hydroxy-5-oxopentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 68714483) has the molecular formula C27H43ClN4O3 and a molecular weight of 507.12 g/mol. Its IUPAC name is 3-[5-amino-1-(3-chlorophenyl)-1-hydroxy-5-oxopentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | 3-[5-amino-1-(3-chlorophenyl)-1-hydroxy-5-oxopentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 68714483 |
| Molecular Formula | C27H43ClN4O3 |
| Molecular Weight | 507.12 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 3-[5-amino-1-(3-chlorophenyl)-1-hydroxy-5-oxopentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNCC(CC1CCCCC1)NC(=O)N1CCCC(C(O)(CCCC(N)=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C27H43ClN4O3/c1-30-18-24(16-20-8-3-2-4-9-20)31-26(34)32-15-7-11-22(19-32)27(35,14-6-13-25(29)33)21-10-5-12-23(28)17-21/h5,10,12,17,20,22,24,30,35H,2-4,6-9,11,13-16,18-19H2,1H3,(H2,29,33)(H,31,34) |
| InChIKey | GQELMDZEQHGFMK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.12 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |