C29H48ClN3O3 — CID 67191243
3-[1-(3-chlorophenyl)-1,5-dimethoxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 67191243) has the molecular formula C29H48ClN3O3 and a molecular weight of 522.17 g/mol. Its IUPAC name is 3-[1-(3-chlorophenyl)-1,5-dimethoxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | 3-[1-(3-chlorophenyl)-1,5-dimethoxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67191243 |
| Molecular Formula | C29H48ClN3O3 |
| Molecular Weight | 522.17 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | 3-[1-(3-chlorophenyl)-1,5-dimethoxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNCC(CC1CCCCC1)NC(=O)N1CCCC(C(CCCCOC)(OC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C29H48ClN3O3/c1-31-21-27(19-23-11-5-4-6-12-23)32-28(34)33-17-10-14-25(22-33)29(36-3,16-7-8-18-35-2)24-13-9-15-26(30)20-24/h9,13,15,20,23,25,27,31H,4-8,10-12,14,16-19,21-22H2,1-3H3,(H,32,34) |
| InChIKey | NWQGAWSQDOCGAP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.17 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|