C27H44ClN3O4 — CID 67192020
2-[1-(3-chlorophenyl)-1-hydroxy-5-methoxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]morpholine-4-carboxamide (PubChem CID 67192020) has the molecular formula C27H44ClN3O4 and a molecular weight of 510.12 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)-1-hydroxy-5-methoxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]morpholine-4-carboxamide.
| Compound Name | 2-[1-(3-chlorophenyl)-1-hydroxy-5-methoxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 67192020 |
| Molecular Formula | C27H44ClN3O4 |
| Molecular Weight | 510.12 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 2-[1-(3-chlorophenyl)-1-hydroxy-5-methoxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]morpholine-4-carboxamide |
| SMILES | CNCC(CC1CCCCC1)NC(=O)N1CCOC(C(O)(CCCCOC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C27H44ClN3O4/c1-29-19-24(17-21-9-4-3-5-10-21)30-26(32)31-14-16-35-25(20-31)27(33,13-6-7-15-34-2)22-11-8-12-23(28)18-22/h8,11-12,18,21,24-25,29,33H,3-7,9-10,13-17,19-20H2,1-2H3,(H,30,32) |
| InChIKey | BXYNZAASFMYLEJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.12 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|