C27H45ClN4O3S — CID 70327806
(3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(methanesulfinamido)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 70327806) has the molecular formula C27H45ClN4O3S and a molecular weight of 541.20 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(methanesulfinamido)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(methanesulfinamido)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 70327806 |
| Molecular Formula | C27H45ClN4O3S |
| Molecular Weight | 541.20 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(methanesulfinamido)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@](O)(CCCNS(C)=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C27H45ClN4O3S/c1-29-19-25(17-21-9-4-3-5-10-21)31-26(33)32-16-7-12-23(20-32)27(34,14-8-15-30-36(2)35)22-11-6-13-24(28)18-22/h6,11,13,18,21,23,25,29-30,34H,3-5,7-10,12,14-17,19-20H2,1-2H3,(H,31,33)/t23-,25+,27-,36?/m1/s1 |
| InChIKey | MCSCRYAIJCLVMZ-RIFCIEKHSA-N |
| XLogP | 4.17 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|