C29H46FN3O4 — CID 68704653
[(2S)-3-cyclohexyl-2-[[(3R)-3-(1-fluoro-5-methoxy-1-phenylpentyl)piperidine-1-carbonyl]amino]propyl]-methylcarbamic acid (PubChem CID 68704653) has the molecular formula C29H46FN3O4 and a molecular weight of 519.70 g/mol. Its IUPAC name is [(2S)-3-cyclohexyl-2-[[(3R)-3-(1-fluoro-5-methoxy-1-phenylpentyl)piperidine-1-carbonyl]amino]propyl]-methylcarbamic acid.
| Compound Name | [(2S)-3-cyclohexyl-2-[[(3R)-3-(1-fluoro-5-methoxy-1-phenylpentyl)piperidine-1-carbonyl]amino]propyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 68704653 |
| Molecular Formula | C29H46FN3O4 |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.35 |
| IUPAC Name | [(2S)-3-cyclohexyl-2-[[(3R)-3-(1-fluoro-5-methoxy-1-phenylpentyl)piperidine-1-carbonyl]amino]propyl]-methylcarbamic acid |
| SMILES | COCCCCC(F)(c1ccccc1)[C@@H]1CCCN(C(=O)N[C@@H](CC2CCCCC2)CN(C)C(=O)O)C1 |
| InChI | InChI=1S/C29H46FN3O4/c1-32(28(35)36)22-26(20-23-12-5-3-6-13-23)31-27(34)33-18-11-16-25(21-33)29(30,17-9-10-19-37-2)24-14-7-4-8-15-24/h4,7-8,14-15,23,25-26H,3,5-6,9-13,16-22H2,1-2H3,(H,31,34)(H,35,36)/t25-,26+,29?/m1/s1 |
| InChIKey | YNNGVGILHJHKQP-SSDKUHEVSA-N |
| XLogP | 6.04 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|