C16H22ClNO — CID 110436627
2-(3-chlorophenyl)-2-methyl-1-(3-methylpiperidin-1-yl)propan-1-one (PubChem CID 110436627) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-methyl-1-(3-methylpiperidin-1-yl)propan-1-one.
| Compound Name | 2-(3-chlorophenyl)-2-methyl-1-(3-methylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110436627 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-(3-chlorophenyl)-2-methyl-1-(3-methylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CCCN(C(=O)C(C)(C)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C16H22ClNO/c1-12-6-5-9-18(11-12)15(19)16(2,3)13-7-4-8-14(17)10-13/h4,7-8,10,12H,5-6,9,11H2,1-3H3 |
| InChIKey | WPXNQCQYYJRZTM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |