C28H48ClNO4Si — CID 59201612
tert-butyl (3R)-3-[(1R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-1-(3-chlorophenyl)butyl]piperidine-1-carboxylate (PubChem CID 59201612) has the molecular formula C28H48ClNO4Si and a molecular weight of 526.23 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-1-(3-chlorophenyl)butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(1R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-1-(3-chlorophenyl)butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59201612 |
| Molecular Formula | C28H48ClNO4Si |
| Molecular Weight | 526.23 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | tert-butyl (3R)-3-[(1R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-1-(3-chlorophenyl)butyl]piperidine-1-carboxylate |
| SMILES | CCC[C@](OCCO[Si](C)(C)C(C)(C)C)(c1cccc(Cl)c1)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C28H48ClNO4Si/c1-10-16-28(22-13-11-15-24(29)20-22,32-18-19-33-35(8,9)27(5,6)7)23-14-12-17-30(21-23)25(31)34-26(2,3)4/h11,13,15,20,23H,10,12,14,16-19,21H2,1-9H3/t23-,28+/m1/s1 |
| InChIKey | INLNQTPMNPWUJS-LXFBAYGMSA-N |
| XLogP | 8.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.23 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|