C21H32ClNO5 — CID 67188750
tert-butyl 3-[(1R)-1-(3-chlorophenyl)-1-hydroxy-2-(2-methoxyethoxy)ethyl]piperidine-1-carboxylate (PubChem CID 67188750) has the molecular formula C21H32ClNO5 and a molecular weight of 413.94 g/mol. Its IUPAC name is tert-butyl 3-[(1R)-1-(3-chlorophenyl)-1-hydroxy-2-(2-methoxyethoxy)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1R)-1-(3-chlorophenyl)-1-hydroxy-2-(2-methoxyethoxy)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67188750 |
| Molecular Formula | C21H32ClNO5 |
| Molecular Weight | 413.94 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | tert-butyl 3-[(1R)-1-(3-chlorophenyl)-1-hydroxy-2-(2-methoxyethoxy)ethyl]piperidine-1-carboxylate |
| SMILES | COCCOC[C@](O)(c1cccc(Cl)c1)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H32ClNO5/c1-20(2,3)28-19(24)23-10-6-8-17(14-23)21(25,15-27-12-11-26-4)16-7-5-9-18(22)13-16/h5,7,9,13,17,25H,6,8,10-12,14-15H2,1-4H3/t17?,21-/m0/s1 |
| InChIKey | APFQUBSZSPGYSD-LFABVHOISA-N |
| XLogP | 3.84 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.94 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|