C22H34BrNO4 — CID 67190161
tert-butyl 3-[(1S)-1-(3-bromophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylate (PubChem CID 67190161) has the molecular formula C22H34BrNO4 and a molecular weight of 456.42 g/mol. Its IUPAC name is tert-butyl 3-[(1S)-1-(3-bromophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1S)-1-(3-bromophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67190161 |
| Molecular Formula | C22H34BrNO4 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | tert-butyl 3-[(1S)-1-(3-bromophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylate |
| SMILES | COCCCC[C@@](O)(c1cccc(Br)c1)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H34BrNO4/c1-21(2,3)28-20(25)24-13-8-10-18(16-24)22(26,12-5-6-14-27-4)17-9-7-11-19(23)15-17/h7,9,11,15,18,26H,5-6,8,10,12-14,16H2,1-4H3/t18?,22-/m1/s1 |
| InChIKey | FGFFORZHOJEWFE-LMNIDFBRSA-N |
| XLogP | 5.10 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|