C29H39FN2O4 — CID 76641334
tert-butyl 3-[4-acetamido-1-[4-fluoro-3-(3-methylphenyl)phenyl]-1-hydroxybutyl]piperidine-1-carboxylate (PubChem CID 76641334) has the molecular formula C29H39FN2O4 and a molecular weight of 498.64 g/mol. Its IUPAC name is tert-butyl 3-[4-acetamido-1-[4-fluoro-3-(3-methylphenyl)phenyl]-1-hydroxybutyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-acetamido-1-[4-fluoro-3-(3-methylphenyl)phenyl]-1-hydroxybutyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 76641334 |
| Molecular Formula | C29H39FN2O4 |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | tert-butyl 3-[4-acetamido-1-[4-fluoro-3-(3-methylphenyl)phenyl]-1-hydroxybutyl]piperidine-1-carboxylate |
| SMILES | CC(=O)NCCCC(O)(c1ccc(F)c(-c2cccc(C)c2)c1)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C29H39FN2O4/c1-20-9-6-10-22(17-20)25-18-23(12-13-26(25)30)29(35,14-8-15-31-21(2)33)24-11-7-16-32(19-24)27(34)36-28(3,4)5/h6,9-10,12-13,17-18,24,35H,7-8,11,14-16,19H2,1-5H3,(H,31,33) |
| InChIKey | MWEOQRMNAKHUOC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|