C32H38FN3O4 — CID 59404689
methyl N-[4-[(3R)-1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxybutyl]carbamate (PubChem CID 59404689) has the molecular formula C32H38FN3O4 and a molecular weight of 547.67 g/mol. Its IUPAC name is methyl N-[4-[(3R)-1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxybutyl]carbamate.
| Compound Name | methyl N-[4-[(3R)-1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 59404689 |
| Molecular Formula | C32H38FN3O4 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | methyl N-[4-[(3R)-1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxybutyl]carbamate |
| SMILES | COC(=O)NCCCC(O)(c1cccc(F)c1-c1cccc(C)c1)[C@@H]1CCCN(C(=O)c2ccc(CN)cc2)C1 |
| InChI | InChI=1S/C32H38FN3O4/c1-22-7-3-8-25(19-22)29-27(10-4-11-28(29)33)32(39,16-6-17-35-31(38)40-2)26-9-5-18-36(21-26)30(37)24-14-12-23(20-34)13-15-24/h3-4,7-8,10-15,19,26,39H,5-6,9,16-18,20-21,34H2,1-2H3,(H,35,38)/t26-,32?/m1/s1 |
| InChIKey | DRIBRMZLTUMGPU-PSPFREQMSA-N |
| XLogP | 5.14 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|