C32H38FN5O4 — CID 69176572
[4-[(3R)-1-[4-[(diaminomethylideneamino)methyl]benzoyl]piperidin-3-yl]-4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxybutyl] carbamate (PubChem CID 69176572) has the molecular formula C32H38FN5O4 and a molecular weight of 575.69 g/mol. Its IUPAC name is [4-[(3R)-1-[4-[(diaminomethylideneamino)methyl]benzoyl]piperidin-3-yl]-4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxybutyl] carbamate.
| Compound Name | [4-[(3R)-1-[4-[(diaminomethylideneamino)methyl]benzoyl]piperidin-3-yl]-4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxybutyl] carbamate |
|---|---|
| PubChem CID | 69176572 |
| Molecular Formula | C32H38FN5O4 |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | [4-[(3R)-1-[4-[(diaminomethylideneamino)methyl]benzoyl]piperidin-3-yl]-4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxybutyl] carbamate |
| SMILES | Cc1cccc(-c2c(F)cccc2C(O)(CCCOC(N)=O)[C@@H]2CCCN(C(=O)c3ccc(CN=C(N)N)cc3)C2)c1 |
| InChI | InChI=1S/C32H38FN5O4/c1-21-6-2-7-24(18-21)28-26(9-3-10-27(28)33)32(41,15-5-17-42-31(36)40)25-8-4-16-38(20-25)29(39)23-13-11-22(12-14-23)19-37-30(34)35/h2-3,6-7,9-14,18,25,41H,4-5,8,15-17,19-20H2,1H3,(H2,36,40)(H4,34,35,37)/t25-,32?/m1/s1 |
| InChIKey | HHCKTPLFVFLXAR-LYYPKXFYSA-N |
| XLogP | 4.19 |
| TPSA | 157.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|