C24H31FN2O3 — CID 68723721
[4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-piperidin-3-ylbutyl] carbamate (PubChem CID 68723721) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is [4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-piperidin-3-ylbutyl] carbamate.
| Compound Name | [4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-piperidin-3-ylbutyl] carbamate |
|---|---|
| PubChem CID | 68723721 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | [4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-piperidin-3-ylbutyl] carbamate |
| SMILES | CCc1cccc(-c2c(F)cccc2C(O)(CCCOC(N)=O)C2CCCNC2)c1 |
| InChI | InChI=1S/C24H31FN2O3/c1-2-17-7-3-8-18(15-17)22-20(10-4-11-21(22)25)24(29,12-6-14-30-23(26)28)19-9-5-13-27-16-19/h3-4,7-8,10-11,15,19,27,29H,2,5-6,9,12-14,16H2,1H3,(H2,26,28) |
| InChIKey | IRYLHZPKIAOOJH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|