C24H31ClN2O2 — CID 89329107
N-[(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]formamide (PubChem CID 89329107) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is N-[(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]formamide.
| Compound Name | N-[(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]formamide |
|---|---|
| PubChem CID | 89329107 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]formamide |
| SMILES | CCc1cccc(-c2c(Cl)cccc2[C@](O)(CCCNC=O)C2CCCNC2)c1 |
| InChI | InChI=1S/C24H31ClN2O2/c1-2-18-7-3-8-19(15-18)23-21(10-4-11-22(23)25)24(29,12-6-14-27-17-28)20-9-5-13-26-16-20/h3-4,7-8,10-11,15,17,20,26,29H,2,5-6,9,12-14,16H2,1H3,(H,27,28)/t20?,24-/m0/s1 |
| InChIKey | CYTAMERESAVXFN-JWIMYKKASA-N |
| XLogP | 4.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|