C25H33ClN2O3 — CID 59332943
N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]-2-hydroxyacetamide (PubChem CID 59332943) has the molecular formula C25H33ClN2O3 and a molecular weight of 445.00 g/mol. Its IUPAC name is N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]-2-hydroxyacetamide.
| Compound Name | N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 59332943 |
| Molecular Formula | C25H33ClN2O3 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]-2-hydroxyacetamide |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(=O)CO)[C@@H]2CCCNC2)c1 |
| InChI | InChI=1S/C25H33ClN2O3/c1-2-18-7-3-8-19(15-18)24-21(10-4-11-22(24)26)25(31,20-9-5-13-27-16-20)12-6-14-28-23(30)17-29/h3-4,7-8,10-11,15,20,27,29,31H,2,5-6,9,12-14,16-17H2,1H3,(H,28,30)/t20-,25?/m1/s1 |
| InChIKey | OQUNRJAHHUEQDH-VGOKPJQXSA-N |
| XLogP | 3.65 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|