C22H29ClN2O4 — CID 140551228
methyl N-[4-[3-chloro-2-(5-methylfuran-2-yl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate (PubChem CID 140551228) has the molecular formula C22H29ClN2O4 and a molecular weight of 420.94 g/mol. Its IUPAC name is methyl N-[4-[3-chloro-2-(5-methylfuran-2-yl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate.
| Compound Name | methyl N-[4-[3-chloro-2-(5-methylfuran-2-yl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 140551228 |
| Molecular Formula | C22H29ClN2O4 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl N-[4-[3-chloro-2-(5-methylfuran-2-yl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate |
| SMILES | COC(=O)NCCCC(O)(c1cccc(Cl)c1-c1ccc(C)o1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C22H29ClN2O4/c1-15-9-10-19(29-15)20-17(7-3-8-18(20)23)22(27,16-6-4-12-24-14-16)11-5-13-25-21(26)28-2/h3,7-10,16,24,27H,4-6,11-14H2,1-2H3,(H,25,26)/t16-,22?/m1/s1 |
| InChIKey | WKLCEUFPSZYHDA-XESZBRCGSA-N |
| XLogP | 4.23 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|