C24H30F2N2O2 — CID 68698333
N-[(4S)-4-[3-fluoro-2-(2-fluoro-5-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]acetamide (PubChem CID 68698333) has the molecular formula C24H30F2N2O2 and a molecular weight of 416.51 g/mol. Its IUPAC name is N-[(4S)-4-[3-fluoro-2-(2-fluoro-5-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]acetamide.
| Compound Name | N-[(4S)-4-[3-fluoro-2-(2-fluoro-5-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]acetamide |
|---|---|
| PubChem CID | 68698333 |
| Molecular Formula | C24H30F2N2O2 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N-[(4S)-4-[3-fluoro-2-(2-fluoro-5-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]acetamide |
| SMILES | CC(=O)NCCC[C@@](O)(c1cccc(F)c1-c1cc(C)ccc1F)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C24H30F2N2O2/c1-16-9-10-21(25)19(14-16)23-20(7-3-8-22(23)26)24(30,11-5-13-28-17(2)29)18-6-4-12-27-15-18/h3,7-10,14,18,27,30H,4-6,11-13,15H2,1-2H3,(H,28,29)/t18-,24+/m1/s1 |
| InChIKey | JJAOCKQXAREQLL-KOSHJBKYSA-N |
| XLogP | 4.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|