C23H29FN2O3 — CID 68692916
[4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid (PubChem CID 68692916) has the molecular formula C23H29FN2O3 and a molecular weight of 400.49 g/mol. Its IUPAC name is [4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid.
| Compound Name | [4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid |
|---|---|
| PubChem CID | 68692916 |
| Molecular Formula | C23H29FN2O3 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid |
| SMILES | Cc1cccc(-c2c(F)cccc2C(O)(CCCNC(=O)O)C2CCCNC2)c1 |
| InChI | InChI=1S/C23H29FN2O3/c1-16-6-2-7-17(14-16)21-19(9-3-10-20(21)24)23(29,11-5-13-26-22(27)28)18-8-4-12-25-15-18/h2-3,6-7,9-10,14,18,25-26,29H,4-5,8,11-13,15H2,1H3,(H,27,28) |
| InChIKey | VHOYMSZIRLHOFT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|