C18H27FN2O2 — CID 67193008
N-[4-(2-fluoro-5-methylphenyl)-4-hydroxy-4-piperidin-3-ylbutyl]acetamide (PubChem CID 67193008) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is N-[4-(2-fluoro-5-methylphenyl)-4-hydroxy-4-piperidin-3-ylbutyl]acetamide.
| Compound Name | N-[4-(2-fluoro-5-methylphenyl)-4-hydroxy-4-piperidin-3-ylbutyl]acetamide |
|---|---|
| PubChem CID | 67193008 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | N-[4-(2-fluoro-5-methylphenyl)-4-hydroxy-4-piperidin-3-ylbutyl]acetamide |
| SMILES | CC(=O)NCCCC(O)(c1cc(C)ccc1F)C1CCCNC1 |
| InChI | InChI=1S/C18H27FN2O2/c1-13-6-7-17(19)16(11-13)18(23,8-4-10-21-14(2)22)15-5-3-9-20-12-15/h6-7,11,15,20,23H,3-5,8-10,12H2,1-2H3,(H,21,22) |
| InChIKey | JYIOOZTYLLSPTK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|