C17H26ClN3O2 — CID 59382838
1-[(4S)-4-(3-chlorophenyl)-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]-3-methylurea (PubChem CID 59382838) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 1-[(4S)-4-(3-chlorophenyl)-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]-3-methylurea.
| Compound Name | 1-[(4S)-4-(3-chlorophenyl)-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]-3-methylurea |
|---|---|
| PubChem CID | 59382838 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[(4S)-4-(3-chlorophenyl)-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]-3-methylurea |
| SMILES | CNC(=O)NCCC[C@@](O)(c1cccc(Cl)c1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-19-16(22)21-10-4-8-17(23,14-6-3-9-20-12-14)13-5-2-7-15(18)11-13/h2,5,7,11,14,20,23H,3-4,6,8-10,12H2,1H3,(H2,19,21,22)/t14-,17-/m1/s1 |
| InChIKey | UBCJIQHCTKJEMI-RHSMWYFYSA-N |
| XLogP | 2.24 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|