C39H59ClF2N4O5 — CID 69469639
N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]-2-methoxypropanamide;N-[(1S)-1-(2,3-difluorophenyl)-5-methoxy-1-piperidin-3-ylpentyl]propanamide (PubChem CID 69469639) has the molecular formula C39H59ClF2N4O5 and a molecular weight of 737.37 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]-2-methoxypropanamide;N-[(1S)-1-(2,3-difluorophenyl)-5-methoxy-1-piperidin-3-ylpentyl]propanamide.
| Compound Name | N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]-2-methoxypropanamide;N-[(1S)-1-(2,3-difluorophenyl)-5-methoxy-1-piperidin-3-ylpentyl]propanamide |
|---|---|
| PubChem CID | 69469639 |
| Molecular Formula | C39H59ClF2N4O5 |
| Molecular Weight | 737.37 g/mol |
| Exact Mass | 736.41 |
| IUPAC Name | N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]-2-methoxypropanamide;N-[(1S)-1-(2,3-difluorophenyl)-5-methoxy-1-piperidin-3-ylpentyl]propanamide |
| SMILES | CCC(=O)N[C@](CCCCOC)(c1cccc(F)c1F)C1CCCNC1.COC(C)C(=O)NCCCC(O)(c1cccc(Cl)c1)C1CCCNC1 |
| InChI | InChI=1S/C20H30F2N2O2.C19H29ClN2O3/c1-3-18(25)24-20(11-4-5-13-26-2,15-8-7-12-23-14-15)16-9-6-10-17(21)19(16)22;1-14(25-2)18(23)22-11-5-9-19(24,16-7-4-10-21-13-16)15-6-3-8-17(20)12-15/h6,9-10,15,23H,3-5,7-8,11-14H2,1-2H3,(H,24,25);3,6,8,12,14,16,21,24H,4-5,7,9-11,13H2,1-2H3,(H,22,23)/t15?,20-;/m0./s1 |
| InChIKey | RUHKYHMSHVTZQI-NAEAKBEESA-N |
| XLogP | 5.96 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.37 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|