C19H29ClN2O3 — CID 67189888
N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]-2-methoxypropanamide (PubChem CID 67189888) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]-2-methoxypropanamide.
| Compound Name | N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]-2-methoxypropanamide |
|---|---|
| PubChem CID | 67189888 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[4-(3-chlorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]-2-methoxypropanamide |
| SMILES | COC(C)C(=O)NCCCC(O)(c1cccc(Cl)c1)C1CCCNC1 |
| InChI | InChI=1S/C19H29ClN2O3/c1-14(25-2)18(23)22-11-5-9-19(24,16-7-4-10-21-13-16)15-6-3-8-17(20)12-15/h3,6,8,12,14,16,21,24H,4-5,7,9-11,13H2,1-2H3,(H,22,23) |
| InChIKey | SDXZGEAGYWBEGU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|