C17H25FN2O3 — CID 68713452
methyl N-[4-(2-fluorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]carbamate (PubChem CID 68713452) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl N-[4-(2-fluorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]carbamate.
| Compound Name | methyl N-[4-(2-fluorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]carbamate |
|---|---|
| PubChem CID | 68713452 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | methyl N-[4-(2-fluorophenyl)-4-hydroxy-4-piperidin-3-ylbutyl]carbamate |
| SMILES | COC(=O)NCCCC(O)(c1ccccc1F)C1CCCNC1 |
| InChI | InChI=1S/C17H25FN2O3/c1-23-16(21)20-11-5-9-17(22,13-6-4-10-19-12-13)14-7-2-3-8-15(14)18/h2-3,7-8,13,19,22H,4-6,9-12H2,1H3,(H,20,21) |
| InChIKey | WZNFYOBWKMUWOH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|