C24H31ClN2O4 — CID 68850063
[4-[3-chloro-2-(2-ethylphenoxy)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid (PubChem CID 68850063) has the molecular formula C24H31ClN2O4 and a molecular weight of 446.98 g/mol. Its IUPAC name is [4-[3-chloro-2-(2-ethylphenoxy)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid.
| Compound Name | [4-[3-chloro-2-(2-ethylphenoxy)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid |
|---|---|
| PubChem CID | 68850063 |
| Molecular Formula | C24H31ClN2O4 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [4-[3-chloro-2-(2-ethylphenoxy)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid |
| SMILES | CCc1ccccc1Oc1c(Cl)cccc1C(O)(CCCNC(=O)O)C1CCCNC1 |
| InChI | InChI=1S/C24H31ClN2O4/c1-2-17-8-3-4-12-21(17)31-22-19(10-5-11-20(22)25)24(30,13-7-15-27-23(28)29)18-9-6-14-26-16-18/h3-5,8,10-12,18,26-27,30H,2,6-7,9,13-16H2,1H3,(H,28,29) |
| InChIKey | VCWUZAROWNVAEY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|