C18H27Cl2NO2 — CID 67190042
(1S)-1-(2,3-dichlorophenyl)-5-ethoxy-1-piperidin-3-ylpentan-1-ol (PubChem CID 67190042) has the molecular formula C18H27Cl2NO2 and a molecular weight of 360.33 g/mol. Its IUPAC name is (1S)-1-(2,3-dichlorophenyl)-5-ethoxy-1-piperidin-3-ylpentan-1-ol.
| Compound Name | (1S)-1-(2,3-dichlorophenyl)-5-ethoxy-1-piperidin-3-ylpentan-1-ol |
|---|---|
| PubChem CID | 67190042 |
| Molecular Formula | C18H27Cl2NO2 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (1S)-1-(2,3-dichlorophenyl)-5-ethoxy-1-piperidin-3-ylpentan-1-ol |
| SMILES | CCOCCCC[C@@](O)(c1cccc(Cl)c1Cl)C1CCCNC1 |
| InChI | InChI=1S/C18H27Cl2NO2/c1-2-23-12-4-3-10-18(22,14-7-6-11-21-13-14)15-8-5-9-16(19)17(15)20/h5,8-9,14,21-22H,2-4,6-7,10-13H2,1H3/t14?,18-/m0/s1 |
| InChIKey | MWAQZHGIWNVZII-IBYPIGCZSA-N |
| XLogP | 4.39 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|