C23H30ClNO2 — CID 141142747
(1S)-1-[2-(2-chlorophenyl)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol (PubChem CID 141142747) has the molecular formula C23H30ClNO2 and a molecular weight of 387.95 g/mol. Its IUPAC name is (1S)-1-[2-(2-chlorophenyl)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol.
| Compound Name | (1S)-1-[2-(2-chlorophenyl)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol |
|---|---|
| PubChem CID | 141142747 |
| Molecular Formula | C23H30ClNO2 |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (1S)-1-[2-(2-chlorophenyl)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1ccccc1-c1ccccc1Cl)C1CCCNC1 |
| InChI | InChI=1S/C23H30ClNO2/c1-27-16-7-6-14-23(26,18-9-8-15-25-17-18)21-12-4-2-10-19(21)20-11-3-5-13-22(20)24/h2-5,10-13,18,25-26H,6-9,14-17H2,1H3/t18?,23-/m0/s1 |
| InChIKey | ZWXZQJCZNQUJOI-IMMUGOHXSA-N |
| XLogP | 5.01 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|