C19H27NO2S — CID 59382913
(1S)-1-(1-benzothiophen-2-yl)-5-methoxy-1-[(3R)-piperidin-3-yl]pentan-1-ol (PubChem CID 59382913) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is (1S)-1-(1-benzothiophen-2-yl)-5-methoxy-1-[(3R)-piperidin-3-yl]pentan-1-ol.
| Compound Name | (1S)-1-(1-benzothiophen-2-yl)-5-methoxy-1-[(3R)-piperidin-3-yl]pentan-1-ol |
|---|---|
| PubChem CID | 59382913 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (1S)-1-(1-benzothiophen-2-yl)-5-methoxy-1-[(3R)-piperidin-3-yl]pentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1cc2ccccc2s1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C19H27NO2S/c1-22-12-5-4-10-19(21,16-8-6-11-20-14-16)18-13-15-7-2-3-9-17(15)23-18/h2-3,7,9,13,16,20-21H,4-6,8,10-12,14H2,1H3/t16-,19+/m1/s1 |
| InChIKey | XEDCGPMOAILOGM-APWZRJJASA-N |
| XLogP | 3.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|