C20H27NO4S — CID 69467936
3-[(1S)-1-(1-benzothiophen-2-yl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylic acid (PubChem CID 69467936) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is 3-[(1S)-1-(1-benzothiophen-2-yl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(1S)-1-(1-benzothiophen-2-yl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69467936 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-[(1S)-1-(1-benzothiophen-2-yl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylic acid |
| SMILES | COCCCC[C@@](O)(c1cc2ccccc2s1)C1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C20H27NO4S/c1-25-12-5-4-10-20(24,16-8-6-11-21(14-16)19(22)23)18-13-15-7-2-3-9-17(15)26-18/h2-3,7,9,13,16,24H,4-6,8,10-12,14H2,1H3,(H,22,23)/t16?,20-/m0/s1 |
| InChIKey | GFNKSAZDCLHCSK-FZCLLLDFSA-N |
| XLogP | 4.30 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|