C28H41N3O4 — CID 67192984
N-(2-aminoethyl)-3-[(1S)-1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]-N-methylpiperidine-1-carboxamide (PubChem CID 67192984) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[(1S)-1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]-N-methylpiperidine-1-carboxamide.
| Compound Name | N-(2-aminoethyl)-3-[(1S)-1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 67192984 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | N-(2-aminoethyl)-3-[(1S)-1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]-N-methylpiperidine-1-carboxamide |
| SMILES | COCCCC[C@@](O)(c1ccccc1Oc1ccccc1C)C1CCCN(C(=O)N(C)CCN)C1 |
| InChI | InChI=1S/C28H41N3O4/c1-22-11-4-6-14-25(22)35-26-15-7-5-13-24(26)28(33,16-8-9-20-34-3)23-12-10-18-31(21-23)27(32)30(2)19-17-29/h4-7,11,13-15,23,33H,8-10,12,16-21,29H2,1-3H3/t23?,28-/m0/s1 |
| InChIKey | ZSHOJMHLZYTICE-WOKNPCPGSA-N |
| XLogP | 4.51 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|