C31H44N2O5 — CID 68990476
(3-amino-4-hydroxycyclopentyl)-[3-[5-ethoxy-1-hydroxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]methanone (PubChem CID 68990476) has the molecular formula C31H44N2O5 and a molecular weight of 524.70 g/mol. Its IUPAC name is (3-amino-4-hydroxycyclopentyl)-[3-[5-ethoxy-1-hydroxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]methanone.
| Compound Name | (3-amino-4-hydroxycyclopentyl)-[3-[5-ethoxy-1-hydroxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 68990476 |
| Molecular Formula | C31H44N2O5 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | (3-amino-4-hydroxycyclopentyl)-[3-[5-ethoxy-1-hydroxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]methanone |
| SMILES | CCOCCCCC(O)(c1ccccc1Oc1ccccc1C)C1CCCN(C(=O)C2CC(N)C(O)C2)C1 |
| InChI | InChI=1S/C31H44N2O5/c1-3-37-18-9-8-16-31(36,25-13-5-7-15-29(25)38-28-14-6-4-11-22(28)2)24-12-10-17-33(21-24)30(35)23-19-26(32)27(34)20-23/h4-7,11,13-15,23-24,26-27,34,36H,3,8-10,12,16-21,32H2,1-2H3 |
| InChIKey | ZZOWVTQXNVRNAA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|