C29H39FN2O4 — CID 68992246
(3-amino-4-hydroxycyclopentyl)-[3-[1-[2-(2-fluorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone (PubChem CID 68992246) has the molecular formula C29H39FN2O4 and a molecular weight of 498.64 g/mol. Its IUPAC name is (3-amino-4-hydroxycyclopentyl)-[3-[1-[2-(2-fluorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone.
| Compound Name | (3-amino-4-hydroxycyclopentyl)-[3-[1-[2-(2-fluorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 68992246 |
| Molecular Formula | C29H39FN2O4 |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | (3-amino-4-hydroxycyclopentyl)-[3-[1-[2-(2-fluorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
| SMILES | COCCCCC(O)(c1ccccc1-c1ccccc1F)C1CCCN(C(=O)C2CC(N)C(O)C2)C1 |
| InChI | InChI=1S/C29H39FN2O4/c1-36-16-7-6-14-29(35,24-12-4-2-10-22(24)23-11-3-5-13-25(23)30)21-9-8-15-32(19-21)28(34)20-17-26(31)27(33)18-20/h2-5,10-13,20-21,26-27,33,35H,6-9,14-19,31H2,1H3 |
| InChIKey | WEOSOCUSAZOYAA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|