C28H38ClN3O3 — CID 24804835
(3-aminopyrrolidin-1-yl)-[3-[1-[2-(2-chlorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone (PubChem CID 24804835) has the molecular formula C28H38ClN3O3 and a molecular weight of 500.08 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-[3-[1-[2-(2-chlorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone.
| Compound Name | (3-aminopyrrolidin-1-yl)-[3-[1-[2-(2-chlorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 24804835 |
| Molecular Formula | C28H38ClN3O3 |
| Molecular Weight | 500.08 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-[3-[1-[2-(2-chlorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
| SMILES | COCCCCC(O)(c1ccccc1-c1ccccc1Cl)C1CCCN(C(=O)N2CCC(N)C2)C1 |
| InChI | InChI=1S/C28H38ClN3O3/c1-35-18-7-6-15-28(34,25-12-4-2-10-23(25)24-11-3-5-13-26(24)29)21-9-8-16-31(19-21)27(33)32-17-14-22(30)20-32/h2-5,10-13,21-22,34H,6-9,14-20,30H2,1H3 |
| InChIKey | QKGIEGHTAAFQEE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.08 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|