C28H38FN3O4 — CID 68990091
(3-aminopyrrolidin-1-yl)-[3-[(1S)-1-[2-(3-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone (PubChem CID 68990091) has the molecular formula C28H38FN3O4 and a molecular weight of 499.63 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-[3-[(1S)-1-[2-(3-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone.
| Compound Name | (3-aminopyrrolidin-1-yl)-[3-[(1S)-1-[2-(3-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 68990091 |
| Molecular Formula | C28H38FN3O4 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-[3-[(1S)-1-[2-(3-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
| SMILES | COCCCC[C@@](O)(c1ccccc1Oc1cccc(F)c1)C1CCCN(C(=O)N2CCC(N)C2)C1 |
| InChI | InChI=1S/C28H38FN3O4/c1-35-17-5-4-14-28(34,21-8-7-15-31(19-21)27(33)32-16-13-23(30)20-32)25-11-2-3-12-26(25)36-24-10-6-9-22(29)18-24/h2-3,6,9-12,18,21,23,34H,4-5,7-8,13-17,19-20,30H2,1H3/t21?,23?,28-/m0/s1 |
| InChIKey | ZWGCIKQXHMGRKO-QZDZRYIRSA-N |
| XLogP | 4.49 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|