C28H40N2O4 — CID 59620446
4-amino-1-[(3R)-3-[(1S)-1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]butan-1-one (PubChem CID 59620446) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is 4-amino-1-[(3R)-3-[(1S)-1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]butan-1-one.
| Compound Name | 4-amino-1-[(3R)-3-[(1S)-1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 59620446 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 4-amino-1-[(3R)-3-[(1S)-1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]butan-1-one |
| SMILES | COCCCC[C@@](O)(c1ccccc1Oc1ccccc1C)[C@@H]1CCCN(C(=O)CCCN)C1 |
| InChI | InChI=1S/C28H40N2O4/c1-22-11-3-5-14-25(22)34-26-15-6-4-13-24(26)28(32,17-7-8-20-33-2)23-12-10-19-30(21-23)27(31)16-9-18-29/h3-6,11,13-15,23,32H,7-10,12,16-21,29H2,1-2H3/t23-,28+/m1/s1 |
| InChIKey | NLTGELYOVIBNSE-LXFBAYGMSA-N |
| XLogP | 4.77 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|