C26H34ClNO4 — CID 145491031
1-[(3R)-3-[(1S)-1-[2-(2-chloro-6-methylphenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]ethanone (PubChem CID 145491031) has the molecular formula C26H34ClNO4 and a molecular weight of 460.01 g/mol. Its IUPAC name is 1-[(3R)-3-[(1S)-1-[2-(2-chloro-6-methylphenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-[(1S)-1-[2-(2-chloro-6-methylphenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 145491031 |
| Molecular Formula | C26H34ClNO4 |
| Molecular Weight | 460.01 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 1-[(3R)-3-[(1S)-1-[2-(2-chloro-6-methylphenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]ethanone |
| SMILES | COCCCC[C@@](O)(c1ccccc1Oc1c(C)cccc1Cl)[C@@H]1CCCN(C(C)=O)C1 |
| InChI | InChI=1S/C26H34ClNO4/c1-19-10-8-13-23(27)25(19)32-24-14-5-4-12-22(24)26(30,15-6-7-17-31-3)21-11-9-16-28(18-21)20(2)29/h4-5,8,10,12-14,21,30H,6-7,9,11,15-18H2,1-3H3/t21-,26+/m1/s1 |
| InChIKey | BPAPPVQYWYXCNF-RLWLMLJZSA-N |
| XLogP | 5.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.01 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|