C31H44N2O4 — CID 68991703
(3-aminocyclohexyl)-[3-[1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]methanone (PubChem CID 68991703) has the molecular formula C31H44N2O4 and a molecular weight of 508.70 g/mol. Its IUPAC name is (3-aminocyclohexyl)-[3-[1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]methanone.
| Compound Name | (3-aminocyclohexyl)-[3-[1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 68991703 |
| Molecular Formula | C31H44N2O4 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | (3-aminocyclohexyl)-[3-[1-hydroxy-5-methoxy-1-[2-(2-methylphenoxy)phenyl]pentyl]piperidin-1-yl]methanone |
| SMILES | COCCCCC(O)(c1ccccc1Oc1ccccc1C)C1CCCN(C(=O)C2CCCC(N)C2)C1 |
| InChI | InChI=1S/C31H44N2O4/c1-23-11-3-5-16-28(23)37-29-17-6-4-15-27(29)31(35,18-7-8-20-36-2)25-13-10-19-33(22-25)30(34)24-12-9-14-26(32)21-24/h3-6,11,15-17,24-26,35H,7-10,12-14,18-22,32H2,1-2H3 |
| InChIKey | AYIJBYALXIECAJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|