C29H39FN2O4 — CID 68993332
[(1R,3S)-3-aminocyclopentyl]-[3-[(1S)-1-[2-(3-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone (PubChem CID 68993332) has the molecular formula C29H39FN2O4 and a molecular weight of 498.64 g/mol. Its IUPAC name is [(1R,3S)-3-aminocyclopentyl]-[3-[(1S)-1-[2-(3-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone.
| Compound Name | [(1R,3S)-3-aminocyclopentyl]-[3-[(1S)-1-[2-(3-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 68993332 |
| Molecular Formula | C29H39FN2O4 |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | [(1R,3S)-3-aminocyclopentyl]-[3-[(1S)-1-[2-(3-fluorophenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
| SMILES | COCCCC[C@@](O)(c1ccccc1Oc1cccc(F)c1)C1CCCN(C(=O)[C@@H]2CC[C@H](N)C2)C1 |
| InChI | InChI=1S/C29H39FN2O4/c1-35-17-5-4-15-29(34,22-8-7-16-32(20-22)28(33)21-13-14-24(31)18-21)26-11-2-3-12-27(26)36-25-10-6-9-23(30)19-25/h2-3,6,9-12,19,21-22,24,34H,4-5,7-8,13-18,20,31H2,1H3/t21-,22?,24+,29+/m1/s1 |
| InChIKey | VEVYSBXLUMNPSG-KGNUTXQNSA-N |
| XLogP | 4.99 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|