C29H40N2O4 — CID 56679709
[(1S,3R)-3-aminocyclopentyl]-[(3R)-3-[(1S)-1-hydroxy-5-methoxy-1-(2-phenoxyphenyl)pentyl]piperidin-1-yl]methanone (PubChem CID 56679709) has the molecular formula C29H40N2O4 and a molecular weight of 480.65 g/mol. Its IUPAC name is [(1S,3R)-3-aminocyclopentyl]-[(3R)-3-[(1S)-1-hydroxy-5-methoxy-1-(2-phenoxyphenyl)pentyl]piperidin-1-yl]methanone.
| Compound Name | [(1S,3R)-3-aminocyclopentyl]-[(3R)-3-[(1S)-1-hydroxy-5-methoxy-1-(2-phenoxyphenyl)pentyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56679709 |
| Molecular Formula | C29H40N2O4 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | [(1S,3R)-3-aminocyclopentyl]-[(3R)-3-[(1S)-1-hydroxy-5-methoxy-1-(2-phenoxyphenyl)pentyl]piperidin-1-yl]methanone |
| SMILES | COCCCC[C@@](O)(c1ccccc1Oc1ccccc1)[C@@H]1CCCN(C(=O)[C@H]2CC[C@@H](N)C2)C1 |
| InChI | InChI=1S/C29H40N2O4/c1-34-19-8-7-17-29(33,26-13-5-6-14-27(26)35-25-11-3-2-4-12-25)23-10-9-18-31(21-23)28(32)22-15-16-24(30)20-22/h2-6,11-14,22-24,33H,7-10,15-21,30H2,1H3/t22-,23+,24+,29-/m0/s1 |
| InChIKey | MTWMQVRCFUVEQV-SEAFADMZSA-N |
| XLogP | 4.85 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|