C34H48N2O6 — CID 59332982
tert-butyl N-[(1S,3R)-3-[(3R)-3-[1-hydroxy-5-methoxy-1-(2-phenoxyphenyl)pentyl]piperidine-1-carbonyl]cyclopentyl]carbamate (PubChem CID 59332982) has the molecular formula C34H48N2O6 and a molecular weight of 580.77 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[(3R)-3-[1-hydroxy-5-methoxy-1-(2-phenoxyphenyl)pentyl]piperidine-1-carbonyl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[(3R)-3-[1-hydroxy-5-methoxy-1-(2-phenoxyphenyl)pentyl]piperidine-1-carbonyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 59332982 |
| Molecular Formula | C34H48N2O6 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[(3R)-3-[1-hydroxy-5-methoxy-1-(2-phenoxyphenyl)pentyl]piperidine-1-carbonyl]cyclopentyl]carbamate |
| SMILES | COCCCCC(O)(c1ccccc1Oc1ccccc1)[C@@H]1CCCN(C(=O)[C@@H]2CC[C@H](NC(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C34H48N2O6/c1-33(2,3)42-32(38)35-27-19-18-25(23-27)31(37)36-21-12-13-26(24-36)34(39,20-10-11-22-40-4)29-16-8-9-17-30(29)41-28-14-6-5-7-15-28/h5-9,14-17,25-27,39H,10-13,18-24H2,1-4H3,(H,35,38)/t25-,26-,27+,34?/m1/s1 |
| InChIKey | ZMKKEUYMJANZMU-RPWLWKFISA-N |
| XLogP | 6.42 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|