C29H39FN2O3 — CID 68991421
[(1R,3S)-3-aminocyclopentyl]-[3-[1-[2-(4-fluorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone (PubChem CID 68991421) has the molecular formula C29H39FN2O3 and a molecular weight of 482.64 g/mol. Its IUPAC name is [(1R,3S)-3-aminocyclopentyl]-[3-[1-[2-(4-fluorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone.
| Compound Name | [(1R,3S)-3-aminocyclopentyl]-[3-[1-[2-(4-fluorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 68991421 |
| Molecular Formula | C29H39FN2O3 |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [(1R,3S)-3-aminocyclopentyl]-[3-[1-[2-(4-fluorophenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
| SMILES | COCCCCC(O)(c1ccccc1-c1ccc(F)cc1)C1CCCN(C(=O)[C@@H]2CC[C@H](N)C2)C1 |
| InChI | InChI=1S/C29H39FN2O3/c1-35-18-5-4-16-29(34,27-9-3-2-8-26(27)21-10-13-24(30)14-11-21)23-7-6-17-32(20-23)28(33)22-12-15-25(31)19-22/h2-3,8-11,13-14,22-23,25,34H,4-7,12,15-20,31H2,1H3/t22-,23?,25+,29?/m1/s1 |
| InChIKey | DVPZCWMOSMAQNC-CAXYUVNFSA-N |
| XLogP | 4.86 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|