C22H33ClFNO4 — CID 59383037
tert-butyl (3R)-3-[(1S)-1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylate (PubChem CID 59383037) has the molecular formula C22H33ClFNO4 and a molecular weight of 429.96 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1S)-1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(1S)-1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59383037 |
| Molecular Formula | C22H33ClFNO4 |
| Molecular Weight | 429.96 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | tert-butyl (3R)-3-[(1S)-1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxylate |
| SMILES | COCCCC[C@@](O)(c1cccc(Cl)c1F)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H33ClFNO4/c1-21(2,3)29-20(26)25-13-8-9-16(15-25)22(27,12-5-6-14-28-4)17-10-7-11-18(23)19(17)24/h7,10-11,16,27H,5-6,8-9,12-15H2,1-4H3/t16-,22+/m1/s1 |
| InChIKey | QMQQWDIEAHLIRE-ZHRRBRCNSA-N |
| XLogP | 5.13 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.96 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|