C29H45ClFN3O3 — CID 67192191
3-[1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]-N-(4-cyclohexylpiperidin-3-yl)piperidine-1-carboxamide (PubChem CID 67192191) has the molecular formula C29H45ClFN3O3 and a molecular weight of 538.15 g/mol. Its IUPAC name is 3-[1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]-N-(4-cyclohexylpiperidin-3-yl)piperidine-1-carboxamide.
| Compound Name | 3-[1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]-N-(4-cyclohexylpiperidin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67192191 |
| Molecular Formula | C29H45ClFN3O3 |
| Molecular Weight | 538.15 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | 3-[1-(3-chloro-2-fluorophenyl)-1-hydroxy-5-methoxypentyl]-N-(4-cyclohexylpiperidin-3-yl)piperidine-1-carboxamide |
| SMILES | COCCCCC(O)(c1cccc(Cl)c1F)C1CCCN(C(=O)NC2CNCCC2C2CCCCC2)C1 |
| InChI | InChI=1S/C29H45ClFN3O3/c1-37-18-6-5-15-29(36,24-12-7-13-25(30)27(24)31)22-11-8-17-34(20-22)28(35)33-26-19-32-16-14-23(26)21-9-3-2-4-10-21/h7,12-13,21-23,26,32,36H,2-6,8-11,14-20H2,1H3,(H,33,35) |
| InChIKey | WYJWOLDWHMHANU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.15 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|