C30H52FN3O3 — CID 143215121
3-cyclohexyl-N-methylpropan-1-amine;3-[1-(2-fluoro-3-methylphenyl)-1-hydroxy-5-methoxypentyl]azepane-1-carboxamide (PubChem CID 143215121) has the molecular formula C30H52FN3O3 and a molecular weight of 521.76 g/mol. Its IUPAC name is 3-cyclohexyl-N-methylpropan-1-amine;3-[1-(2-fluoro-3-methylphenyl)-1-hydroxy-5-methoxypentyl]azepane-1-carboxamide.
| Compound Name | 3-cyclohexyl-N-methylpropan-1-amine;3-[1-(2-fluoro-3-methylphenyl)-1-hydroxy-5-methoxypentyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 143215121 |
| Molecular Formula | C30H52FN3O3 |
| Molecular Weight | 521.76 g/mol |
| Exact Mass | 521.40 |
| IUPAC Name | 3-cyclohexyl-N-methylpropan-1-amine;3-[1-(2-fluoro-3-methylphenyl)-1-hydroxy-5-methoxypentyl]azepane-1-carboxamide |
| SMILES | CNCCCC1CCCCC1.COCCCCC(O)(c1cccc(C)c1F)C1CCCCN(C(N)=O)C1 |
| InChI | InChI=1S/C20H31FN2O3.C10H21N/c1-15-8-7-10-17(18(15)21)20(25,11-4-6-13-26-2)16-9-3-5-12-23(14-16)19(22)24;1-11-9-5-8-10-6-3-2-4-7-10/h7-8,10,16,25H,3-6,9,11-14H2,1-2H3,(H2,22,24);10-11H,2-9H2,1H3 |
| InChIKey | PXGYLSJZRLVSAW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.76 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|