C24H30F3NO2 — CID 71163984
(1S)-5-methoxy-1-[(3R)-piperidin-3-yl]-1-[2-[3-(trifluoromethyl)phenyl]phenyl]pentan-1-ol (PubChem CID 71163984) has the molecular formula C24H30F3NO2 and a molecular weight of 421.50 g/mol. Its IUPAC name is (1S)-5-methoxy-1-[(3R)-piperidin-3-yl]-1-[2-[3-(trifluoromethyl)phenyl]phenyl]pentan-1-ol.
| Compound Name | (1S)-5-methoxy-1-[(3R)-piperidin-3-yl]-1-[2-[3-(trifluoromethyl)phenyl]phenyl]pentan-1-ol |
|---|---|
| PubChem CID | 71163984 |
| Molecular Formula | C24H30F3NO2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (1S)-5-methoxy-1-[(3R)-piperidin-3-yl]-1-[2-[3-(trifluoromethyl)phenyl]phenyl]pentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1ccccc1-c1cccc(C(F)(F)F)c1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C24H30F3NO2/c1-30-15-5-4-13-23(29,20-10-7-14-28-17-20)22-12-3-2-11-21(22)18-8-6-9-19(16-18)24(25,26)27/h2-3,6,8-9,11-12,16,20,28-29H,4-5,7,10,13-15,17H2,1H3/t20-,23+/m1/s1 |
| InChIKey | LXWDXZKXUSBQCM-OFNKIYASSA-N |
| XLogP | 5.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|