C22H35NO2SSi — CID 67189286
(1S)-5-methoxy-1-piperidin-3-yl-1-(2-trimethylsilyl-1-benzothiophen-4-yl)pentan-1-ol (PubChem CID 67189286) has the molecular formula C22H35NO2SSi and a molecular weight of 405.68 g/mol. Its IUPAC name is (1S)-5-methoxy-1-piperidin-3-yl-1-(2-trimethylsilyl-1-benzothiophen-4-yl)pentan-1-ol.
| Compound Name | (1S)-5-methoxy-1-piperidin-3-yl-1-(2-trimethylsilyl-1-benzothiophen-4-yl)pentan-1-ol |
|---|---|
| PubChem CID | 67189286 |
| Molecular Formula | C22H35NO2SSi |
| Molecular Weight | 405.68 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (1S)-5-methoxy-1-piperidin-3-yl-1-(2-trimethylsilyl-1-benzothiophen-4-yl)pentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1cccc2sc([Si](C)(C)C)cc12)C1CCCNC1 |
| InChI | InChI=1S/C22H35NO2SSi/c1-25-14-6-5-12-22(24,17-9-8-13-23-16-17)19-10-7-11-20-18(19)15-21(26-20)27(2,3)4/h7,10-11,15,17,23-24H,5-6,8-9,12-14,16H2,1-4H3/t17?,22-/m0/s1 |
| InChIKey | CALRSNDYEVOBQP-UGNFMNBCSA-N |
| XLogP | 4.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|