C22H37NO3 — CID 68992484
(1R)-1-[2-(2,2-dimethylpropoxy)phenyl]-5-methoxy-1-[(3S)-piperidin-3-yl]pentan-1-ol (PubChem CID 68992484) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is (1R)-1-[2-(2,2-dimethylpropoxy)phenyl]-5-methoxy-1-[(3S)-piperidin-3-yl]pentan-1-ol.
| Compound Name | (1R)-1-[2-(2,2-dimethylpropoxy)phenyl]-5-methoxy-1-[(3S)-piperidin-3-yl]pentan-1-ol |
|---|---|
| PubChem CID | 68992484 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | (1R)-1-[2-(2,2-dimethylpropoxy)phenyl]-5-methoxy-1-[(3S)-piperidin-3-yl]pentan-1-ol |
| SMILES | COCCCC[C@](O)(c1ccccc1OCC(C)(C)C)[C@H]1CCCNC1 |
| InChI | InChI=1S/C22H37NO3/c1-21(2,3)17-26-20-12-6-5-11-19(20)22(24,13-7-8-15-25-4)18-10-9-14-23-16-18/h5-6,11-12,18,23-24H,7-10,13-17H2,1-4H3/t18-,22+/m0/s1 |
| InChIKey | OXYAYRSESLTCLK-PGRDOPGGSA-N |
| XLogP | 4.12 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|