C24H32FNO3 — CID 67191338
(1S)-1-[2-(4-fluoro-2-methylphenoxy)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol (PubChem CID 67191338) has the molecular formula C24H32FNO3 and a molecular weight of 401.52 g/mol. Its IUPAC name is (1S)-1-[2-(4-fluoro-2-methylphenoxy)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol.
| Compound Name | (1S)-1-[2-(4-fluoro-2-methylphenoxy)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol |
|---|---|
| PubChem CID | 67191338 |
| Molecular Formula | C24H32FNO3 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (1S)-1-[2-(4-fluoro-2-methylphenoxy)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1ccccc1Oc1ccc(F)cc1C)C1CCCNC1 |
| InChI | InChI=1S/C24H32FNO3/c1-18-16-20(25)11-12-22(18)29-23-10-4-3-9-21(23)24(27,13-5-6-15-28-2)19-8-7-14-26-17-19/h3-4,9-12,16,19,26-27H,5-8,13-15,17H2,1-2H3/t19?,24-/m0/s1 |
| InChIKey | JWJXTJSYXNVZAK-WIIYFNMSSA-N |
| XLogP | 4.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|