C25H35NO3 — CID 67190101
(1S)-5-methoxy-1-[3-methyl-2-(2-methylphenoxy)phenyl]-1-[(3R)-piperidin-3-yl]pentan-1-ol (PubChem CID 67190101) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is (1S)-5-methoxy-1-[3-methyl-2-(2-methylphenoxy)phenyl]-1-[(3R)-piperidin-3-yl]pentan-1-ol.
| Compound Name | (1S)-5-methoxy-1-[3-methyl-2-(2-methylphenoxy)phenyl]-1-[(3R)-piperidin-3-yl]pentan-1-ol |
|---|---|
| PubChem CID | 67190101 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (1S)-5-methoxy-1-[3-methyl-2-(2-methylphenoxy)phenyl]-1-[(3R)-piperidin-3-yl]pentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1cccc(C)c1Oc1ccccc1C)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C25H35NO3/c1-19-10-4-5-14-23(19)29-24-20(2)11-8-13-22(24)25(27,15-6-7-17-28-3)21-12-9-16-26-18-21/h4-5,8,10-11,13-14,21,26-27H,6-7,9,12,15-18H2,1-3H3/t21-,25+/m1/s1 |
| InChIKey | WHAORJPWTUXDMX-BWKNWUBXSA-N |
| XLogP | 5.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|