C24H32FNO2 — CID 67191148
(1S)-1-[3-fluoro-2-(3-methylphenyl)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol (PubChem CID 67191148) has the molecular formula C24H32FNO2 and a molecular weight of 385.52 g/mol. Its IUPAC name is (1S)-1-[3-fluoro-2-(3-methylphenyl)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol.
| Compound Name | (1S)-1-[3-fluoro-2-(3-methylphenyl)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol |
|---|---|
| PubChem CID | 67191148 |
| Molecular Formula | C24H32FNO2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (1S)-1-[3-fluoro-2-(3-methylphenyl)phenyl]-5-methoxy-1-piperidin-3-ylpentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1cccc(F)c1-c1cccc(C)c1)C1CCCNC1 |
| InChI | InChI=1S/C24H32FNO2/c1-18-8-5-9-19(16-18)23-21(11-6-12-22(23)25)24(27,13-3-4-15-28-2)20-10-7-14-26-17-20/h5-6,8-9,11-12,16,20,26-27H,3-4,7,10,13-15,17H2,1-2H3/t20?,24-/m0/s1 |
| InChIKey | CLQVHUSSJDWAGH-JWIMYKKASA-N |
| XLogP | 4.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|