C26H36FNO2 — CID 143558326
1-[2-(3-ethylphenyl)-3-fluorophenyl]-5-methoxy-1-(1-methylpiperidin-3-yl)pentan-1-ol (PubChem CID 143558326) has the molecular formula C26H36FNO2 and a molecular weight of 413.58 g/mol. Its IUPAC name is 1-[2-(3-ethylphenyl)-3-fluorophenyl]-5-methoxy-1-(1-methylpiperidin-3-yl)pentan-1-ol.
| Compound Name | 1-[2-(3-ethylphenyl)-3-fluorophenyl]-5-methoxy-1-(1-methylpiperidin-3-yl)pentan-1-ol |
|---|---|
| PubChem CID | 143558326 |
| Molecular Formula | C26H36FNO2 |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 1-[2-(3-ethylphenyl)-3-fluorophenyl]-5-methoxy-1-(1-methylpiperidin-3-yl)pentan-1-ol |
| SMILES | CCc1cccc(-c2c(F)cccc2C(O)(CCCCOC)C2CCCN(C)C2)c1 |
| InChI | InChI=1S/C26H36FNO2/c1-4-20-10-7-11-21(18-20)25-23(13-8-14-24(25)27)26(29,15-5-6-17-30-3)22-12-9-16-28(2)19-22/h7-8,10-11,13-14,18,22,29H,4-6,9,12,15-17,19H2,1-3H3 |
| InChIKey | KHQLTHVUSKQGNR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|